CAS 1516055-29-0 is the registry number for 5-Bromo-6-(1H-1,2,4-triazol-1-yl)pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-(1,2,4-triazol-1-yl)pyridin-3-amine (CAS 1516055-29-0) is a chemical compound with the molecular formula C7H6BrN5 and a molecular weight of 240.06 g/mol. IUPAC name: 5-bromo-6-(1,2,4-triazol-1-yl)pyridin-3-amine. InChIKey: CMHIBARQLFUFMG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN5 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 5-bromo-6-(1,2,4-triazol-1-yl)pyridin-3-amine |
| InChIKey | CMHIBARQLFUFMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)N2C=NC=N2)N |
Computed by PubChem (NCBI)