CAS 1249405-89-7 appears in our catalog under these names: 4,4-Dimethyl-1-(thiophen-3-yl)pentane-1,3-dione, 98%, 4,4-Dimethyl-1-(thiophen-3-yl)pentane-1,3-dione, 95%, 95%, 3-hydroxy-4,4-dimethyl-1-(thiophen-3-yl)pent-2-en-1-one, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
4,4-dimethyl-1-thiophen-3-ylpentane-1,3-dione (CAS 1249405-89-7) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 4,4-dimethyl-1-thiophen-3-ylpentane-1,3-dione. InChIKey: QUHKQRXKWSEEBV-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 4,4-dimethyl-1-thiophen-3-ylpentane-1,3-dione |
| InChIKey | QUHKQRXKWSEEBV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C1=CSC=C1 |
Computed by PubChem (NCBI)