Products 1249431-17-1
CAS 1249431-17-1 is the registry number for 4-Bromo-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-bromo-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline (CAS 1249431-17-1) is a chemical compound with the molecular formula C11H10BrN3O and a molecular weight of 280.12 g/mol. IUPAC name: 4-bromo-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: MWXCGJBGDOZRPU-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | 4-bromo-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | MWXCGJBGDOZRPU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=N2)C3=C(C=CC(=C3)Br)N |
Computed by PubChem (NCBI)