CAS 957484-11-6 is the registry number for N-(4-Bromophenyl)-2-methylpyrazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 500mg.
N-(4-bromophenyl)-2-methylpyrazole-3-carboxamide (CAS 957484-11-6) is a chemical compound with the molecular formula C11H10BrN3O and a molecular weight of 280.12 g/mol. IUPAC name: N-(4-bromophenyl)-2-methylpyrazole-3-carboxamide. InChIKey: OBWNZEARNRHAID-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-methylpyrazole-3-carboxamide |
| InChIKey | OBWNZEARNRHAID-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)