Products 124957-41-1
CAS 124957-41-1 is the registry number for Methyl 2-(acetoxy(4-methoxyphenyl)methyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-[acetyloxy-(4-methoxyphenyl)methyl]prop-2-enoate (CAS 124957-41-1) is a chemical compound with the molecular formula C14H16O5 and a molecular weight of 264.27 g/mol. IUPAC name: methyl 2-[acetyloxy-(4-methoxyphenyl)methyl]prop-2-enoate. InChIKey: XBCRXHRIVDBBQT-UHFFFAOYSA-N.
| Molecular formula | C14H16O5 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | methyl 2-[acetyloxy-(4-methoxyphenyl)methyl]prop-2-enoate |
| InChIKey | XBCRXHRIVDBBQT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=C(C=C1)OC)C(=C)C(=O)OC |
Computed by PubChem (NCBI)