CAS 40713-26-6 is the registry number for 6,7-Diethoxy-3-methyl-1-benzofuran-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6,7-diethoxy-3-methyl-1-benzofuran-2-carboxylic acid (CAS 40713-26-6) is a chemical compound with the molecular formula C14H16O5 and a molecular weight of 264.27 g/mol. IUPAC name: 6,7-diethoxy-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: KSMNICDRZDYPNA-UHFFFAOYSA-N.
| Molecular formula | C14H16O5 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 6,7-diethoxy-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | KSMNICDRZDYPNA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=C(C=C1)C(=C(O2)C(=O)O)C)OCC |
Computed by PubChem (NCBI)