CAS 1249616-29-2 appears in our catalog under these names: 2,2-Dimethyl-1-(3-methylpyridin-2-yl)propan-1-amine, 95%, 2,2-Dimethyl-1-(3-methylpyridin-2-yl)propan-1-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2,2-dimethyl-1-(3-methyl-2-pyridinyl)propan-1-amine (CAS 1249616-29-2) is a chemical compound with the molecular formula C11H18N2 and a molecular weight of 178.27 g/mol. IUPAC name: 2,2-dimethyl-1-(3-methyl-2-pyridinyl)propan-1-amine. InChIKey: YYCWWTRKRRLKER-UHFFFAOYSA-N.
| Molecular formula | C11H18N2 |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2,2-dimethyl-1-(3-methyl-2-pyridinyl)propan-1-amine |
| InChIKey | YYCWWTRKRRLKER-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)C(C(C)(C)C)N |
Computed by PubChem (NCBI)