CAS 2095-02-5 is the registry number for Diethyltoluenediamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,4-diethyl-6-methylbenzene-1,3-diamine (CAS 2095-02-5) is a chemical compound with the molecular formula C11H18N2 and a molecular weight of 178.27 g/mol. IUPAC name: 2,4-diethyl-6-methylbenzene-1,3-diamine. InChIKey: PISLZQACAJMAIO-UHFFFAOYSA-N.
| Molecular formula | C11H18N2 |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2,4-diethyl-6-methylbenzene-1,3-diamine |
| InChIKey | PISLZQACAJMAIO-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=C1)C)N)CC)N |
Computed by PubChem (NCBI)