CAS 1249632-63-0 appears in our catalog under these names: 1-(1-Bromo-2-methylpropyl)-2,4-difluorobenzene, 95%, 1-(1-Bromo-2-methylpropyl)-2,4-difluorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(1-bromo-2-methylpropyl)-2,4-difluorobenzene (CAS 1249632-63-0) is a chemical compound with the molecular formula C10H11BrF2 and a molecular weight of 249.09 g/mol. IUPAC name: 1-(1-bromo-2-methylpropyl)-2,4-difluorobenzene. InChIKey: HNQVCWOSEGJYSC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 1-(1-bromo-2-methylpropyl)-2,4-difluorobenzene |
| InChIKey | HNQVCWOSEGJYSC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)