CAS 2654753-01-0 is the registry number for 2-Bromo-5-(tert-butyl)-1,3-difluorobenzene, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-5-tert-butyl-1,3-difluorobenzene (CAS 2654753-01-0) is a chemical compound with the molecular formula C10H11BrF2 and a molecular weight of 249.09 g/mol. IUPAC name: 2-bromo-5-tert-butyl-1,3-difluorobenzene. InChIKey: ZBXUHDFWSOVTKA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2-bromo-5-tert-butyl-1,3-difluorobenzene |
| InChIKey | ZBXUHDFWSOVTKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)F)Br)F |
Computed by PubChem (NCBI)