Products 1249648-03-0
CAS 1249648-03-0 is the registry number for tert-Butyl 3-amino-4-bromobenzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl 3-amino-4-bromobenzoate (CAS 1249648-03-0) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 3-amino-4-bromobenzoate. InChIKey: KPQQLTNLUIDWIF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 3-amino-4-bromobenzoate |
| InChIKey | KPQQLTNLUIDWIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)