CAS 1249675-43-1 appears in our catalog under these names: 4-(3-Iodophenoxy)pyridine, 95%, 4-(3-Iodophenoxy)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(3-iodophenoxy)pyridine (CAS 1249675-43-1) is a chemical compound with the molecular formula C11H8INO and a molecular weight of 297.09 g/mol. IUPAC name: 4-(3-iodophenoxy)pyridine. InChIKey: PJKJELUHQCPKAP-UHFFFAOYSA-N.
| Molecular formula | C11H8INO |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | 4-(3-iodophenoxy)pyridine |
| InChIKey | PJKJELUHQCPKAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)OC2=CC=NC=C2 |
Computed by PubChem (NCBI)