CAS 754214-57-8 appears in our catalog under these names: 3-Iodo-2-phenoxypyridine, 95%, 3-Iodo-2-phenoxypyridine, ≥95%, ≥95%, 3-Iodo-2-phenoxypyridine. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
3-iodo-2-phenoxypyridine (CAS 754214-57-8) is a chemical compound with the molecular formula C11H8INO and a molecular weight of 297.09 g/mol. IUPAC name: 3-iodo-2-phenoxypyridine. InChIKey: JVVIVAQZNSROHX-UHFFFAOYSA-N.
| Molecular formula | C11H8INO |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | 3-iodo-2-phenoxypyridine |
| InChIKey | JVVIVAQZNSROHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)I |
Computed by PubChem (NCBI)