CAS 1249677-08-4 appears in our catalog under these names: 2-(4-Amino-3-fluorophenoxy)-N,N-dimethylacetamide, 2-(4-Amino-3-fluorophenoxy)-N,N-dimethylacetamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-(4-amino-3-fluorophenoxy)-N,N-dimethylacetamide (CAS 1249677-08-4) is a chemical compound with the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. IUPAC name: 2-(4-amino-3-fluorophenoxy)-N,N-dimethylacetamide. InChIKey: VNDZSXJKUDTTMP-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2-(4-amino-3-fluorophenoxy)-N,N-dimethylacetamide |
| InChIKey | VNDZSXJKUDTTMP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=CC(=C(C=C1)N)F |
Computed by PubChem (NCBI)