CAS 1249765-50-1 appears in our catalog under these names: 3-(Propan-2-yl)-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole, 95%, 3-(Propan-2-yl)-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole (CAS 1249765-50-1) is a chemical compound with the molecular formula C7H10F3N3 and a molecular weight of 193.17 g/mol. IUPAC name: 3-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole. InChIKey: DHFTXTWMVFUNGP-UHFFFAOYSA-N.
| Molecular formula | C7H10F3N3 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 3-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole |
| InChIKey | DHFTXTWMVFUNGP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NNC(=N1)CC(F)(F)F |
Computed by PubChem (NCBI)