CAS 1249784-25-5 is the registry number for 2-Methyl-4-(1H-1,2,4-triazol-1-yl)benzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-methyl-4-(1,2,4-triazol-1-yl)benzaldehyde (CAS 1249784-25-5) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 2-methyl-4-(1,2,4-triazol-1-yl)benzaldehyde. InChIKey: MJZUHMJFAQLMGK-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 2-methyl-4-(1,2,4-triazol-1-yl)benzaldehyde |
| InChIKey | MJZUHMJFAQLMGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=NC=N2)C=O |
Computed by PubChem (NCBI)