CAS 1249896-03-4 is the registry number for N-Butyl-2,3-difluoro-6-nitroaniline, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-butyl-2,3-difluoro-6-nitroaniline (CAS 1249896-03-4) is a chemical compound with the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. IUPAC name: N-butyl-2,3-difluoro-6-nitroaniline. InChIKey: FJWJZNBNYYMEQK-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2O2 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | N-butyl-2,3-difluoro-6-nitroaniline |
| InChIKey | FJWJZNBNYYMEQK-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)