CAS 2803933-43-7 is the registry number for (R)-1-(3-(1,1-Difluoroethyl)-5-nitrophenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethanamine (CAS 2803933-43-7) is a chemical compound with the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. IUPAC name: (1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethanamine. InChIKey: VDAIJRSNARVGBG-ZCFIWIBFSA-N.
| Molecular formula | C10H12F2N2O2 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | (1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethanamine |
| InChIKey | VDAIJRSNARVGBG-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)[N+](=O)[O-])C(C)(F)F)N |
Computed by PubChem (NCBI)