Products 125010-17-5
CAS 125010-17-5 is the registry number for Lignarenone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,5E,7E)-3-methyl-8-phenylocta-3,5,7-trien-2-one (CAS 125010-17-5) is a chemical compound with the molecular formula C15H16O and a molecular weight of 212.29 g/mol. IUPAC name: (3E,5E,7E)-3-methyl-8-phenylocta-3,5,7-trien-2-one. InChIKey: DLEPTASFXXJVDU-XVZDYSDNSA-N.
| Molecular formula | C15H16O |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (3E,5E,7E)-3-methyl-8-phenylocta-3,5,7-trien-2-one |
| InChIKey | DLEPTASFXXJVDU-XVZDYSDNSA-N |
| SMILES | C/C(=C\C=C\C=C\C1=CC=CC=C1)/C(=O)C |
Computed by PubChem (NCBI)