CAS 14189-53-8 is the registry number for (3,4-Dimethylphenyl)(phenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3,4-dimethylphenyl)-phenylmethanol (CAS 14189-53-8) is a chemical compound with the molecular formula C15H16O and a molecular weight of 212.29 g/mol. IUPAC name: (3,4-dimethylphenyl)-phenylmethanol. InChIKey: LAAGXZRHDPERJB-UHFFFAOYSA-N.
| Molecular formula | C15H16O |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (3,4-dimethylphenyl)-phenylmethanol |
| InChIKey | LAAGXZRHDPERJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)