Products 1250180-62-1
CAS 1250180-62-1 is the registry number for 1-(4-chloro-2-methoxyphenyl)cyclopropan-1-ol, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chloro-2-methoxyphenyl)cyclopropan-1-ol (CAS 1250180-62-1) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 1-(4-chloro-2-methoxyphenyl)cyclopropan-1-ol. InChIKey: XTMPZCOUZSLWOJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 1-(4-chloro-2-methoxyphenyl)cyclopropan-1-ol |
| InChIKey | XTMPZCOUZSLWOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2(CC2)O |
Computed by PubChem (NCBI)