CAS 1250209-15-4 appears in our catalog under these names: 5-Chloro-7-methyl-1,3-benzoxazol-2-amine, 95%, 5-Chloro-7-methyl-1,3-benzoxazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-7-methyl-1,3-benzoxazol-2-amine (CAS 1250209-15-4) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 5-chloro-7-methyl-1,3-benzoxazol-2-amine. InChIKey: GJFBSBJBPSHPJC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 5-chloro-7-methyl-1,3-benzoxazol-2-amine |
| InChIKey | GJFBSBJBPSHPJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OC(=N2)N)Cl |
Computed by PubChem (NCBI)