Products 1250639-21-4
CAS 1250639-21-4 is the registry number for 5-(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)pentan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentan-1-ol (CAS 1250639-21-4) is a chemical compound with the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. IUPAC name: 5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentan-1-ol. InChIKey: ZEGGFLCQUAJWRA-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O3 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentan-1-ol |
| InChIKey | ZEGGFLCQUAJWRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCCCCO)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)