CAS 1338698-17-1 is the registry number for tert-Butyl (S)-(1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamate (CAS 1338698-17-1) is a chemical compound with the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamate. InChIKey: KRZNFMNCDPFVSA-LURJTMIESA-N.
| Molecular formula | C10H17N3O3 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]carbamate |
| InChIKey | KRZNFMNCDPFVSA-LURJTMIESA-N |
| SMILES | CC1=NOC(=N1)[C@H](C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)