Products 1250742-44-9

CAS 1250742-44-9 appears in our catalog under these names: 4-(Propane-1-sulfonyl)benzene-1-sulfonyl chloride, 95%, 4-(Propane-1-sulfonyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

4-propylsulfonylbenzenesulfonyl chloride (CAS 1250742-44-9) is a chemical compound with the molecular formula C9H11ClO4S2 and a molecular weight of 282.8 g/mol. IUPAC name: 4-propylsulfonylbenzenesulfonyl chloride. InChIKey: ZWHGSOACWLFGCI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S2
Molecular weight282.8 g/mol
IUPAC name4-propylsulfonylbenzenesulfonyl chloride
InChIKeyZWHGSOACWLFGCI-UHFFFAOYSA-N
SMILESCCCS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)