CAS 1258639-68-7 appears in our catalog under these names: 3-Methanesulfonyl-2,5-dimethylbenzene-1-sulfonyl chloride, 95%, 2,5-Dimethyl-3-(methylsulfonyl)benzene-1-sulfonyl chloride, 95%, 3-Methanesulfonyl-2,5-dimethylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride (CAS 1258639-68-7) is a chemical compound with the molecular formula C9H11ClO4S2 and a molecular weight of 282.8 g/mol. IUPAC name: 2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride. InChIKey: ZJOWCZXFVXWKDQ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO4S2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | ZJOWCZXFVXWKDQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)Cl)C)S(=O)(=O)C |
Computed by PubChem (NCBI)