Products 1258639-68-7

CAS 1258639-68-7 appears in our catalog under these names: 3-Methanesulfonyl-2,5-dimethylbenzene-1-sulfonyl chloride, 95%, 2,5-Dimethyl-3-(methylsulfonyl)benzene-1-sulfonyl chloride, 95%, 3-Methanesulfonyl-2,5-dimethylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride (CAS 1258639-68-7) is a chemical compound with the molecular formula C9H11ClO4S2 and a molecular weight of 282.8 g/mol. IUPAC name: 2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride. InChIKey: ZJOWCZXFVXWKDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO4S2
Molecular weight282.8 g/mol
IUPAC name2,5-dimethyl-3-methylsulfonylbenzenesulfonyl chloride
InChIKeyZJOWCZXFVXWKDQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)S(=O)(=O)Cl)C)S(=O)(=O)C

Computed by PubChem (NCBI)