Products 1250779-80-6

CAS 1250779-80-6 appears in our catalog under these names: 2,2–difluoro–2–(2–fluorophenyl)acetic acid, 2,2-Difluoro-2-(2-fluorophenyl)acetic acid, 2,2-Difluoro-2-(2-fluorophenyl)acetic acid, 98%, 98%, 2,2-difluoro-2-(2-fluorophenyl)acetic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 0,5g, 250mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(2-fluorophenyl)acetic acid (CAS 1250779-80-6) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,2-difluoro-2-(2-fluorophenyl)acetic acid. InChIKey: MEUKKMRCOPFQAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O2
Molecular weight190.12 g/mol
IUPAC name2,2-difluoro-2-(2-fluorophenyl)acetic acid
InChIKeyMEUKKMRCOPFQAQ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(C(=O)O)(F)F)F

Computed by PubChem (NCBI)