CAS 1250779-80-6 appears in our catalog under these names: 2,2–difluoro–2–(2–fluorophenyl)acetic acid, 2,2-Difluoro-2-(2-fluorophenyl)acetic acid, 2,2-Difluoro-2-(2-fluorophenyl)acetic acid, 98%, 98%, 2,2-difluoro-2-(2-fluorophenyl)acetic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 0,5g, 250mg.
2,2-difluoro-2-(2-fluorophenyl)acetic acid (CAS 1250779-80-6) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,2-difluoro-2-(2-fluorophenyl)acetic acid. InChIKey: MEUKKMRCOPFQAQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-fluorophenyl)acetic acid |
| InChIKey | MEUKKMRCOPFQAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)(F)F)F |
Computed by PubChem (NCBI)