Products 1250884-13-9
CAS 1250884-13-9 is the registry number for tert–Butyl (5S)–5–amino–2–azabicyclo(2·2·1)heptane–2–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl (5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1250884-13-9) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: HGLKMYOTFGKEDG-HACHORDNSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | HGLKMYOTFGKEDG-HACHORDNSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C[C@@H]2N |
Computed by PubChem (NCBI)