Products 2402697-38-3
CAS 2402697-38-3 is the registry number for (1S,4R,5S)-tert-Butyl 5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,4R,5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 2402697-38-3) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,4R,5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: HGLKMYOTFGKEDG-VGMNWLOBSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,4R,5S)-5-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | HGLKMYOTFGKEDG-VGMNWLOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@H]1C[C@@H]2N |
Computed by PubChem (NCBI)