CAS 1250900-11-8 is the registry number for 4-Ethyl-1-phenyl-1h-pyrazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-ethyl-1-phenylpyrazol-5-amine (CAS 1250900-11-8) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 4-ethyl-1-phenylpyrazol-5-amine. InChIKey: NQRSLLGEBCJYNF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 4-ethyl-1-phenylpyrazol-5-amine |
| InChIKey | NQRSLLGEBCJYNF-UHFFFAOYSA-N |
| SMILES | CCC1=C(N(N=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)