CAS 125091-45-4 appears in our catalog under these names: 2-Chloro-6-((4-chlorophenyl)sulfanyl)benzoic acid, 2-Chloro-6-((4-chlorophenyl)sulfanyl)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
2-chloro-6-(4-chlorophenyl)sulfanylbenzoic acid (CAS 125091-45-4) is a chemical compound with the molecular formula C13H8Cl2O2S and a molecular weight of 299.2 g/mol. IUPAC name: 2-chloro-6-(4-chlorophenyl)sulfanylbenzoic acid. InChIKey: PLXZYDNEHLDUNJ-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2S |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 2-chloro-6-(4-chlorophenyl)sulfanylbenzoic acid |
| InChIKey | PLXZYDNEHLDUNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)