Products 20092-54-0

CAS 20092-54-0 is the registry number for 4-Chloro-2-((4-chlorophenyl)sulfanyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-chloro-2-(4-chlorophenyl)sulfanylbenzoic acid (CAS 20092-54-0) is a chemical compound with the molecular formula C13H8Cl2O2S and a molecular weight of 299.2 g/mol. IUPAC name: 4-chloro-2-(4-chlorophenyl)sulfanylbenzoic acid. InChIKey: CENXGFUFMFJOCH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl2O2S
Molecular weight299.2 g/mol
IUPAC name4-chloro-2-(4-chlorophenyl)sulfanylbenzoic acid
InChIKeyCENXGFUFMFJOCH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1SC2=C(C=CC(=C2)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)