Products 1250995-70-0
CAS 1250995-70-0 is the registry number for tert-butyl endo-3-hydroxy-6-azabicyclo[3.2.1]octane-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1R,3R,5S)-3-hydroxy-6-azabicyclo[3.2.1]octane-6-carboxylate (CAS 1250995-70-0) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (1R,3R,5S)-3-hydroxy-6-azabicyclo[3.2.1]octane-6-carboxylate. InChIKey: UYQWTUFQGNHJIK-KXUCPTDWSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (1R,3R,5S)-3-hydroxy-6-azabicyclo[3.2.1]octane-6-carboxylate |
| InChIKey | UYQWTUFQGNHJIK-KXUCPTDWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C[C@@H](C2)O |
Computed by PubChem (NCBI)