Products 1251004-65-5
CAS 1251004-65-5 is the registry number for tert-Butyl 3-amino-5,6,8,9-tetrahydro-7H-pyrido[2,3-d]azepine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-amino-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate (CAS 1251004-65-5) is a chemical compound with the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. IUPAC name: tert-butyl 3-amino-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate. InChIKey: CXCVKECEFCOAOJ-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O2 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | tert-butyl 3-amino-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
| InChIKey | CXCVKECEFCOAOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(CC1)N=CC(=C2)N |
Computed by PubChem (NCBI)