CAS 1251007-27-8 is the registry number for rel-(3aR,6aS)-5,5-Difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (CAS 1251007-27-8) is a chemical compound with the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. IUPAC name: (3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole. InChIKey: HQFKSNZDIHXZME-OLQVQODUSA-N.
| Molecular formula | C7H11F2N |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| InChIKey | HQFKSNZDIHXZME-OLQVQODUSA-N |
| SMILES | C1[C@@H]2CNC[C@@H]2CC1(F)F |
Computed by PubChem (NCBI)