CAS 1251008-46-4 is the registry number for Cis-4,4-difluorooctahydrocyclopenta[c]pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
(3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (CAS 1251008-46-4) is a chemical compound with the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. IUPAC name: (3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole. InChIKey: AXWZHQLOPCLIMR-RITPCOANSA-N.
| Molecular formula | C7H11F2N |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| InChIKey | AXWZHQLOPCLIMR-RITPCOANSA-N |
| SMILES | C1CC([C@@H]2[C@H]1CNC2)(F)F |
Computed by PubChem (NCBI)