Products 1251076-14-8

CAS 1251076-14-8 appears in our catalog under these names: 4-(tert-Butyl)piperidine-1-sulfonyl chloride, 97%, 4-tert-Butylpiperidine-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-tert-butylpiperidine-1-sulfonyl chloride (CAS 1251076-14-8) is a chemical compound with the molecular formula C9H18ClNO2S and a molecular weight of 239.76 g/mol. IUPAC name: 4-tert-butylpiperidine-1-sulfonyl chloride. InChIKey: YVFQNPFZUSXBEL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2S
Molecular weight239.76 g/mol
IUPAC name4-tert-butylpiperidine-1-sulfonyl chloride
InChIKeyYVFQNPFZUSXBEL-UHFFFAOYSA-N
SMILESCC(C)(C)C1CCN(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)