CAS 2306271-04-3 is the registry number for 9-Thia-2-azaspiro(5.5)undecane 9,9-dioxide hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide;hydrochloride (CAS 2306271-04-3) is a chemical compound with the molecular formula C9H18ClNO2S and a molecular weight of 239.76 g/mol. IUPAC name: 9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide;hydrochloride. InChIKey: AGWSQSDEKUPVCF-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO2S |
|---|---|
| Molecular weight | 239.76 g/mol |
| IUPAC name | 9lambda6-thia-2-azaspiro[5.5]undecane 9,9-dioxide;hydrochloride |
| InChIKey | AGWSQSDEKUPVCF-UHFFFAOYSA-N |
| SMILES | C1CC2(CCS(=O)(=O)CC2)CNC1.Cl |
Computed by PubChem (NCBI)