Products 1251355-24-4

CAS 1251355-24-4 is the registry number for 2-(1H-1,2,4-Triazol-3-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylic acid (CAS 1251355-24-4) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylic acid. InChIKey: XSEMHAHPSXESOA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O2
Molecular weight153.14 g/mol
IUPAC name2-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylic acid
InChIKeyXSEMHAHPSXESOA-UHFFFAOYSA-N
SMILESC1C(C1C(=O)O)C2=NC=NN2

Computed by PubChem (NCBI)