Products 1251462-28-8
CAS 1251462-28-8 is the registry number for JNJ 28610244. Offered by: MedChemExpress. Available pack sizes: Get quote.
(NZ)-N-[(5-methyl-1H-indol-2-yl)-(1-methylpiperidin-4-yl)methylidene]hydroxylamine (CAS 1251462-28-8) is a chemical compound with the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. IUPAC name: (NZ)-N-[(5-methyl-1H-indol-2-yl)-(1-methylpiperidin-4-yl)methylidene]hydroxylamine. InChIKey: VOIJIMTXMUBFDD-VLGSPTGOSA-N.
| Molecular formula | C16H21N3O |
|---|---|
| Molecular weight | 271.36 g/mol |
| IUPAC name | (NZ)-N-[(5-methyl-1H-indol-2-yl)-(1-methylpiperidin-4-yl)methylidene]hydroxylamine |
| InChIKey | VOIJIMTXMUBFDD-VLGSPTGOSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=C2)/C(=N\O)/C3CCN(CC3)C |
Computed by PubChem (NCBI)