CAS 60317-19-3 is the registry number for Tripelennamine N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide (CAS 60317-19-3) is a chemical compound with the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. IUPAC name: 2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide. InChIKey: MSTJFFJNICHTPK-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O |
|---|---|
| Molecular weight | 271.36 g/mol |
| IUPAC name | 2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide |
| InChIKey | MSTJFFJNICHTPK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCN(CC1=CC=CC=C1)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)