Products 60317-19-3

CAS 60317-19-3 is the registry number for Tripelennamine N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.

Structural formula: {0} (CAS {1})

2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide (CAS 60317-19-3) is a chemical compound with the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. IUPAC name: 2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide. InChIKey: MSTJFFJNICHTPK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21N3O
Molecular weight271.36 g/mol
IUPAC name2-[benzyl(pyridin-2-yl)amino]-N,N-dimethylethanamine oxide
InChIKeyMSTJFFJNICHTPK-UHFFFAOYSA-N
SMILESC[N+](C)(CCN(CC1=CC=CC=C1)C2=CC=CC=N2)[O-]

Computed by PubChem (NCBI)