CAS 1251537-39-9 appears in our catalog under these names: (1-(Tert-butoxycarbonyl)piperidin-4-yl)boronic acid, 98%, 98%, (1-(tert-Butoxycarbonyl)piperidin-4-yl)boronic acid, 98%, (1-(tert-Butoxycarbonyl)piperidin-4-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g.
[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]boronic acid (CAS 1251537-39-9) is a chemical compound with the molecular formula C10H20BNO4 and a molecular weight of 229.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]boronic acid. InChIKey: KMECCEOFWNIQFT-UHFFFAOYSA-N.
| Molecular formula | C10H20BNO4 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]boronic acid |
| InChIKey | KMECCEOFWNIQFT-UHFFFAOYSA-N |
| SMILES | B(C1CCN(CC1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)