CAS 2437328-09-9 is the registry number for (3-((2S,3R)-2-(Ethoxycarbonyl)pyrrolidin-3-yl)propyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid (CAS 2437328-09-9) is a chemical compound with the molecular formula C10H20BNO4 and a molecular weight of 229.08 g/mol. IUPAC name: 3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid. InChIKey: ZQLOXSFUWXKCIM-BDAKNGLRSA-N.
| Molecular formula | C10H20BNO4 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | 3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid |
| InChIKey | ZQLOXSFUWXKCIM-BDAKNGLRSA-N |
| SMILES | B(CCC[C@@H]1CCN[C@@H]1C(=O)OCC)(O)O |
Computed by PubChem (NCBI)