Products 2437328-09-9

CAS 2437328-09-9 is the registry number for (3-((2S,3R)-2-(Ethoxycarbonyl)pyrrolidin-3-yl)propyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid (CAS 2437328-09-9) is a chemical compound with the molecular formula C10H20BNO4 and a molecular weight of 229.08 g/mol. IUPAC name: 3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid. InChIKey: ZQLOXSFUWXKCIM-BDAKNGLRSA-N.

Identity
Molecular formulaC10H20BNO4
Molecular weight229.08 g/mol
IUPAC name3-[(2S,3R)-2-ethoxycarbonylpyrrolidin-3-yl]propylboronic acid
InChIKeyZQLOXSFUWXKCIM-BDAKNGLRSA-N
SMILESB(CCC[C@@H]1CCN[C@@H]1C(=O)OCC)(O)O

Computed by PubChem (NCBI)