CAS 1251573-85-9 is the registry number for 2-[(3-Ethylphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3-ethylanilino)pyridine-3-sulfonamide (CAS 1251573-85-9) is a chemical compound with the molecular formula C13H15N3O2S and a molecular weight of 277.34 g/mol. IUPAC name: 2-(3-ethylanilino)pyridine-3-sulfonamide. InChIKey: FRZIUDXGAGYHJC-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | 2-(3-ethylanilino)pyridine-3-sulfonamide |
| InChIKey | FRZIUDXGAGYHJC-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)NC2=C(C=CC=N2)S(=O)(=O)N |
Computed by PubChem (NCBI)