CAS 1251634-31-7 is the registry number for 2-[(3,5-Dimethylphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3,5-dimethylanilino)pyridine-3-sulfonamide (CAS 1251634-31-7) is a chemical compound with the molecular formula C13H15N3O2S and a molecular weight of 277.34 g/mol. IUPAC name: 2-(3,5-dimethylanilino)pyridine-3-sulfonamide. InChIKey: WLFZTSHXCYTTSA-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | 2-(3,5-dimethylanilino)pyridine-3-sulfonamide |
| InChIKey | WLFZTSHXCYTTSA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC2=C(C=CC=N2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)