Products 1251668-09-3
CAS 1251668-09-3 is the registry number for 2-(4',5-Dimethoxy-(1,1'-biphenyl)-2-yl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-[4-methoxy-2-(4-methoxyphenyl)phenyl]pyridine (CAS 1251668-09-3) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2-[4-methoxy-2-(4-methoxyphenyl)phenyl]pyridine. InChIKey: VKDZHMNOSVPPRJ-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2-[4-methoxy-2-(4-methoxyphenyl)phenyl]pyridine |
| InChIKey | VKDZHMNOSVPPRJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=CC(=C2)OC)C3=CC=CC=N3 |
Computed by PubChem (NCBI)