CAS 1251675-80-5 is the registry number for Ethyl 3-([3-(aminosulfonyl)pyridin-2-yl]amino)benzoate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3-[(3-sulfamoyl-2-pyridinyl)amino]benzoate (CAS 1251675-80-5) is a chemical compound with the molecular formula C14H15N3O4S and a molecular weight of 321.35 g/mol. IUPAC name: ethyl 3-[(3-sulfamoyl-2-pyridinyl)amino]benzoate. InChIKey: UHIMAUQXAAPUPF-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O4S |
|---|---|
| Molecular weight | 321.35 g/mol |
| IUPAC name | ethyl 3-[(3-sulfamoyl-2-pyridinyl)amino]benzoate |
| InChIKey | UHIMAUQXAAPUPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC2=C(C=CC=N2)S(=O)(=O)N |
Computed by PubChem (NCBI)