CAS 719269-35-9 is the registry number for 1-(6-methoxy(3-pyridyl))-3-((4-methylphenyl)sulfonyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(6-methoxy-3-pyridinyl)-3-(4-methylphenyl)sulfonylurea (CAS 719269-35-9) is a chemical compound with the molecular formula C14H15N3O4S and a molecular weight of 321.35 g/mol. IUPAC name: 1-(6-methoxy-3-pyridinyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: LUHPQZVSQHWZDR-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O4S |
|---|---|
| Molecular weight | 321.35 g/mol |
| IUPAC name | 1-(6-methoxy-3-pyridinyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | LUHPQZVSQHWZDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CN=C(C=C2)OC |
Computed by PubChem (NCBI)