CAS 1251848-80-2 appears in our catalog under these names: 2-(5-(tert-Butyl)thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 5–(tert–Butyl)thiophene–2–boronic acid pinacol ester. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 25mg.
2-(5-tert-butylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1251848-80-2) is a chemical compound with the molecular formula C14H23BO2S and a molecular weight of 266.2 g/mol. IUPAC name: 2-(5-tert-butylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: USUGMJSRDLAGTR-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2S |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 2-(5-tert-butylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | USUGMJSRDLAGTR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(C)(C)C |
Computed by PubChem (NCBI)