CAS 2223049-73-6 is the registry number for 2–(iso–Butyl)thiophene–4–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
4,4,5,5-tetramethyl-2-[5-(2-methylpropyl)thiophen-3-yl]-1,3,2-dioxaborolane (CAS 2223049-73-6) is a chemical compound with the molecular formula C14H23BO2S and a molecular weight of 266.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-(2-methylpropyl)thiophen-3-yl]-1,3,2-dioxaborolane. InChIKey: GXSNUUAQLIAVER-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2S |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-(2-methylpropyl)thiophen-3-yl]-1,3,2-dioxaborolane |
| InChIKey | GXSNUUAQLIAVER-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)CC(C)C |
Computed by PubChem (NCBI)